C21H21FN4O2 — CID 42213796
N-[(4R)-1-(3-fluorophenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 42213796) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[(4R)-1-(3-fluorophenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[(4R)-1-(3-fluorophenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 42213796 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[(4R)-1-(3-fluorophenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | CC1(C)Cc2c(cnn2-c2cccc(F)c2)[C@H](NC(=O)c2ccc[n+]([O-])c2)C1 |
| InChI | InChI=1S/C21H21FN4O2/c1-21(2)10-18(24-20(27)14-5-4-8-25(28)13-14)17-12-23-26(19(17)11-21)16-7-3-6-15(22)9-16/h3-9,12-13,18H,10-11H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | YSQGEBZSROTEPN-GOSISDBHSA-N |
| XLogP | 3.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|