C27H27N3O4S — CID 42213984
N-[[3-methyl-7-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42213984) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[[3-methyl-7-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[3-methyl-7-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42213984 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[[3-methyl-7-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ncc2c(c1CNC(=O)c1ccc3c(c1)OCO3)CCN(C(=O)c1csc3c1CCCC3)C2 |
| InChI | InChI=1S/C27H27N3O4S/c1-16-21(12-29-26(31)17-6-7-23-24(10-17)34-15-33-23)19-8-9-30(13-18(19)11-28-16)27(32)22-14-35-25-5-3-2-4-20(22)25/h6-7,10-11,14H,2-5,8-9,12-13,15H2,1H3,(H,29,31) |
| InChIKey | RDYDGGJHJWBDMR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |