About [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone
[2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 42214245) has the molecular formula C14H13FN2O4
and a molecular weight of 292.27 g/mol. Its IUPAC name is [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone.
Molecular Properties
| Compound Name | [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| PubChem CID | 42214245 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C(c1coc(COc2ccccc2F)n1)N1CCCO1 |
| InChI | InChI=1S/C14H13FN2O4/c15-10-4-1-2-5-12(10)19-9-13-16-11(8-20-13)14(18)17-6-3-7-21-17/h1-2,4-5,8H,3,6-7,9H2 |
| InChIKey | HYAPNZXRXZQVQT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone?
The IUPAC name of [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone (CID 42214245) is [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone.
What is the SMILES notation for [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone?
The canonical SMILES for [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone is O=C(c1coc(COc2ccccc2F)n1)N1CCCO1.
What is the InChIKey of [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone?
The InChIKey is HYAPNZXRXZQVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O4/c15-10-4-1-2-5-12(10)19-9-13-16-11(8-20-13)14(18)17-6-3-7-21-17/h1-2,4-5,8H,3,6-7,9H2.
What are the key properties of [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone?
[2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone has a molecular weight of 292.27 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-fluorophenoxy)methyl]-1,3-oxazol-4-yl]-(1,2-oxazolidin-2-yl)methanone is sourced from PubChem (CID 42214245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).