C9H11F3N6O2 — CID 42214528
6-N-(2-methoxyethyl)-5-N-(2,2,2-trifluoroethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 42214528) has the molecular formula C9H11F3N6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-5-N-(2,2,2-trifluoroethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(2-methoxyethyl)-5-N-(2,2,2-trifluoroethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 42214528 |
| Molecular Formula | C9H11F3N6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-N-(2-methoxyethyl)-5-N-(2,2,2-trifluoroethyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | COCCNc1nc2nonc2nc1NCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N6O2/c1-19-3-2-13-5-6(14-4-9(10,11)12)16-8-7(15-5)17-20-18-8/h2-4H2,1H3,(H,13,15,17)(H,14,16,18) |
| InChIKey | UKSVLICLDMVKHR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|