C20H22FNO4S — CID 42214782
[(3S)-1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-(2-methoxyphenyl)methanone (PubChem CID 42214782) has the molecular formula C20H22FNO4S and a molecular weight of 391.46 g/mol. Its IUPAC name is [(3S)-1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(3S)-1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42214782 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(3S)-1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2C)C1 |
| InChI | InChI=1S/C20H22FNO4S/c1-14-9-10-16(21)12-19(14)27(24,25)22-11-5-6-15(13-22)20(23)17-7-3-4-8-18(17)26-2/h3-4,7-10,12,15H,5-6,11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | WKFRDXHFODDBQD-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |