C22H24F3NO2 — CID 42214871
1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 42214871) has the molecular formula C22H24F3NO2 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 42214871 |
| Molecular Formula | C22H24F3NO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CCO[C@@H](CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H24F3NO2/c23-22(24,25)12-11-21(27)26-13-14-28-19(16-26)15-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,19-20H,11-16H2/t19-/m0/s1 |
| InChIKey | HVISBMREAKBQES-IBGZPJMESA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |