C23H31NO4 — CID 42215033
[(3S)-3-benzyl-1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-3-yl]methanol (PubChem CID 42215033) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is [(3S)-3-benzyl-1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-3-yl]methanol.
| Compound Name | [(3S)-3-benzyl-1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 42215033 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | [(3S)-3-benzyl-1-[(2,4,5-trimethoxyphenyl)methyl]piperidin-3-yl]methanol |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCC[C@](CO)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H31NO4/c1-26-20-13-22(28-3)21(27-2)12-19(20)15-24-11-7-10-23(16-24,17-25)14-18-8-5-4-6-9-18/h4-6,8-9,12-13,25H,7,10-11,14-17H2,1-3H3/t23-/m0/s1 |
| InChIKey | HLMNFTOXVFVORC-QHCPKHFHSA-N |
| XLogP | 3.53 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |