C24H29N3O2 — CID 42217546
2-ethoxy-N-[(2S)-2-(1-methylpyrrol-2-yl)-2-pyrrolidin-1-ylethyl]naphthalene-1-carboxamide (PubChem CID 42217546) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-ethoxy-N-[(2S)-2-(1-methylpyrrol-2-yl)-2-pyrrolidin-1-ylethyl]naphthalene-1-carboxamide.
| Compound Name | 2-ethoxy-N-[(2S)-2-(1-methylpyrrol-2-yl)-2-pyrrolidin-1-ylethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 42217546 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-ethoxy-N-[(2S)-2-(1-methylpyrrol-2-yl)-2-pyrrolidin-1-ylethyl]naphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NC[C@@H](c1cccn1C)N1CCCC1 |
| InChI | InChI=1S/C24H29N3O2/c1-3-29-22-13-12-18-9-4-5-10-19(18)23(22)24(28)25-17-21(27-15-6-7-16-27)20-11-8-14-26(20)2/h4-5,8-14,21H,3,6-7,15-17H2,1-2H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | AATOOZTTYOTYFY-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |