C32H29N2OS2+ — CID 4221769
3-ethyl-2-[[3-ethyl-6-[2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]benzo[g][1,3]benzothiazole (PubChem CID 4221769) has the molecular formula C32H29N2OS2+ and a molecular weight of 521.73 g/mol. Its IUPAC name is 3-ethyl-2-[[3-ethyl-6-[2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]benzo[g][1,3]benzothiazole.
| Compound Name | 3-ethyl-2-[[3-ethyl-6-[2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]benzo[g][1,3]benzothiazole |
|---|---|
| PubChem CID | 4221769 |
| Molecular Formula | C32H29N2OS2+ |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-ethyl-2-[[3-ethyl-6-[2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]benzo[g][1,3]benzothiazole |
| SMILES | CCN1C(=Cc2sc3cc(C=Cc4ccc(OC)cc4)ccc3[n+]2CC)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C32H29N2OS2/c1-4-33-27-18-14-23(11-10-22-12-16-25(35-3)17-13-22)20-29(27)36-30(33)21-31-34(5-2)28-19-15-24-8-6-7-9-26(24)32(28)37-31/h6-21H,4-5H2,1-3H3/q+1 |
| InChIKey | ASEHURLMODPIHD-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|