C19H21N3O3 — CID 42223532
2-[2-[3-[2-(dimethylazaniumyl)ethoxy]phenyl]benzimidazol-1-yl]acetate (PubChem CID 42223532) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[2-[3-[2-(dimethylazaniumyl)ethoxy]phenyl]benzimidazol-1-yl]acetate.
| Compound Name | 2-[2-[3-[2-(dimethylazaniumyl)ethoxy]phenyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 42223532 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[2-[3-[2-(dimethylazaniumyl)ethoxy]phenyl]benzimidazol-1-yl]acetate |
| SMILES | C[NH+](C)CCOc1cccc(-c2nc3ccccc3n2CC(=O)[O-])c1 |
| InChI | InChI=1S/C19H21N3O3/c1-21(2)10-11-25-15-7-5-6-14(12-15)19-20-16-8-3-4-9-17(16)22(19)13-18(23)24/h3-9,12H,10-11,13H2,1-2H3,(H,23,24) |
| InChIKey | UXCQYDUZZHSWGW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |