C20H23N3O5S2 — CID 42227729
4-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide (PubChem CID 42227729) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide.
| Compound Name | 4-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42227729 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
| SMILES | C[C@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccc(N4CCCC4)cc3)cc2)C1=O |
| InChI | InChI=1S/C20H23N3O5S2/c1-15-14-29(25,26)23(20(15)24)18-8-10-19(11-9-18)30(27,28)21-16-4-6-17(7-5-16)22-12-2-3-13-22/h4-11,15,21H,2-3,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | LFOKSJAFCIFEMQ-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|