C21H29N3O4S — CID 4222776
methyl 2-[[2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate (PubChem CID 4222776) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is methyl 2-[[2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4222776 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl 2-[[2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
| SMILES | CCCC/N=C1\SC(CC(=O)Nc2ccccc2C(=O)OC)C(=O)N1CCCC |
| InChI | InChI=1S/C21H29N3O4S/c1-4-6-12-22-21-24(13-7-5-2)19(26)17(29-21)14-18(25)23-16-11-9-8-10-15(16)20(27)28-3/h8-11,17H,4-7,12-14H2,1-3H3,(H,23,25)/b22-21- |
| InChIKey | OMFVYOAOSUEIQM-DQRAZIAOSA-N |
| XLogP | 3.70 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|