C19H20N4O6S — CID 4222783
methyl 4-[[(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]benzoate (PubChem CID 4222783) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is methyl 4-[[(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4222783 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | methyl 4-[[(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O6S/c1-29-19(24)15-6-4-14(5-7-15)13-20-21-17-9-8-16(12-18(17)23(25)26)30(27,28)22-10-2-3-11-22/h4-9,12-13,21H,2-3,10-11H2,1H3 |
| InChIKey | VXDKOBMJOCOLBP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|