C26H24N2O6S — CID 4223397
methyl 4-[2,5-dimethyl-3-[2-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]oxyacetyl]pyrrol-1-yl]benzoate (PubChem CID 4223397) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-[2-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]oxyacetyl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-[2-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]oxyacetyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4223397 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-[2-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]oxyacetyl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)COC(=O)CC3Sc4ccccc4NC3=O)c2C)cc1 |
| InChI | InChI=1S/C26H24N2O6S/c1-15-12-19(16(2)28(15)18-10-8-17(9-11-18)26(32)33-3)21(29)14-34-24(30)13-23-25(31)27-20-6-4-5-7-22(20)35-23/h4-12,23H,13-14H2,1-3H3,(H,27,31) |
| InChIKey | DSRPMKKQDHXERE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|