C24H30N2O5 — CID 4223407
(2-nitrophenyl)methyl 2-[(3,5-ditert-butylbenzoyl)amino]acetate (PubChem CID 4223407) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-[(3,5-ditert-butylbenzoyl)amino]acetate.
| Compound Name | (2-nitrophenyl)methyl 2-[(3,5-ditert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4223407 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2-nitrophenyl)methyl 2-[(3,5-ditert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)(C)c1cc(C(=O)NCC(=O)OCc2ccccc2[N+](=O)[O-])cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N2O5/c1-23(2,3)18-11-17(12-19(13-18)24(4,5)6)22(28)25-14-21(27)31-15-16-9-7-8-10-20(16)26(29)30/h7-13H,14-15H2,1-6H3,(H,25,28) |
| InChIKey | POUVSLSYKNNNJO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|