C25H38N6O2S — CID 42238898
N-[(1S)-1-[7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide (PubChem CID 42238898) has the molecular formula C25H38N6O2S and a molecular weight of 486.69 g/mol. Its IUPAC name is N-[(1S)-1-[7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide.
| Compound Name | N-[(1S)-1-[7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 42238898 |
| Molecular Formula | C25H38N6O2S |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | N-[(1S)-1-[7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCOCC1)c1nnc2n1CCN(Cc1ccc(CN3CCCCC3)s1)CC2 |
| InChI | InChI=1S/C25H38N6O2S/c1-19(26-25(32)20-8-15-33-16-9-20)24-28-27-23-7-12-30(13-14-31(23)24)18-22-6-5-21(34-22)17-29-10-3-2-4-11-29/h5-6,19-20H,2-4,7-18H2,1H3,(H,26,32)/t19-/m0/s1 |
| InChIKey | BSHGREKBRMYPCM-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |