C18H23N3O3S — CID 42243962
N-[(2R)-3-hydroxy-3-prop-2-enylhex-5-en-2-yl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide (PubChem CID 42243962) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[(2R)-3-hydroxy-3-prop-2-enylhex-5-en-2-yl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide.
| Compound Name | N-[(2R)-3-hydroxy-3-prop-2-enylhex-5-en-2-yl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 42243962 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2R)-3-hydroxy-3-prop-2-enylhex-5-en-2-yl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide |
| SMILES | C=CCC(O)(CC=C)[C@@H](C)NC(=O)CCc1nnc(-c2ccsc2)o1 |
| InChI | InChI=1S/C18H23N3O3S/c1-4-9-18(23,10-5-2)13(3)19-15(22)6-7-16-20-21-17(24-16)14-8-11-25-12-14/h4-5,8,11-13,23H,1-2,6-7,9-10H2,3H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | ANMFOFBHGNZAEJ-CYBMUJFWSA-N |
| XLogP | 3.12 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|