methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate

C18H23N3O3 — CID 42244095

IUPACmethyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate
SMILESCOC(=O)c1ccc(-c2noc(CN3CCCCCCC3)n2)cc1
InChIInChI=1S/C18H23N3O3/c1-23-18(22)15-9-7-14(8-10-15)17-19-16(24-20-17)13-21-11-5-3-2-4-6-12-21/h7-10H,2-6,11-13H2,1H3
InChIKeyUZQRMEVKILIDLJ-UHFFFAOYSA-N
MW329.40 g/mol
LogP3.29
Rot. Bonds4

About methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate

methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 42244095) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate.

Molecular Properties

Compound Namemethyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate
PubChem CID42244095
Molecular FormulaC18H23N3O3
Molecular Weight329.40 g/mol
Exact Mass329.17
IUPAC Namemethyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate
SMILESCOC(=O)c1ccc(-c2noc(CN3CCCCCCC3)n2)cc1
InChIInChI=1S/C18H23N3O3/c1-23-18(22)15-9-7-14(8-10-15)17-19-16(24-20-17)13-21-11-5-3-2-4-6-12-21/h7-10H,2-6,11-13H2,1H3
InChIKeyUZQRMEVKILIDLJ-UHFFFAOYSA-N
XLogP3.29
TPSA68.46 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.40
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate?
The IUPAC name of methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate (CID 42244095) is methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate.
What is the SMILES notation for methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate?
The canonical SMILES for methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate is COC(=O)c1ccc(-c2noc(CN3CCCCCCC3)n2)cc1.
What is the InChIKey of methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate?
The InChIKey is UZQRMEVKILIDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-23-18(22)15-9-7-14(8-10-15)17-19-16(24-20-17)13-21-11-5-3-2-4-6-12-21/h7-10H,2-6,11-13H2,1H3.
What are the key properties of methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate?
methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate has a molecular weight of 329.40 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate is sourced from PubChem (CID 42244095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).