C18H23N3O3 — CID 42244095
methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 42244095) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 42244095 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | methyl 4-[5-(azocan-1-ylmethyl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2noc(CN3CCCCCCC3)n2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-23-18(22)15-9-7-14(8-10-15)17-19-16(24-20-17)13-21-11-5-3-2-4-6-12-21/h7-10H,2-6,11-13H2,1H3 |
| InChIKey | UZQRMEVKILIDLJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |