C16H17N3OS — CID 4224550
3-ethyl-4-phenyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-ol (PubChem CID 4224550) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-ethyl-4-phenyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-ol.
| Compound Name | 3-ethyl-4-phenyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 4224550 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-ethyl-4-phenyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-ol |
| SMILES | CCN1C(=Nc2ccccn2)SCC1(O)c1ccccc1 |
| InChI | InChI=1S/C16H17N3OS/c1-2-19-15(18-14-10-6-7-11-17-14)21-12-16(19,20)13-8-4-3-5-9-13/h3-11,20H,2,12H2,1H3 |
| InChIKey | KTSMHJBFCVPBOA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|