About N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide
N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide (PubChem CID 4224571) has the molecular formula C15H17Cl2N3OS
and a molecular weight of 358.29 g/mol. Its IUPAC name is N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide.
Molecular Properties
| Compound Name | N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide |
| PubChem CID | 4224571 |
| Molecular Formula | C15H17Cl2N3OS |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide |
| SMILES | Cc1ccc(/C(=N/C=C(Cl)Cl)NC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H17Cl2N3OS/c1-11-2-4-12(5-3-11)14(18-10-13(16)17)19-15(22)20-6-8-21-9-7-20/h2-5,10H,6-9H2,1H3,(H,18,19,22) |
| InChIKey | XBESBEHFUWZAGJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide?
The IUPAC name of N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide (CID 4224571) is N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide.
What is the SMILES notation for N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide?
The canonical SMILES for N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide is Cc1ccc(/C(=N/C=C(Cl)Cl)NC(=S)N2CCOCC2)cc1.
What is the InChIKey of N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide?
The InChIKey is XBESBEHFUWZAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2N3OS/c1-11-2-4-12(5-3-11)14(18-10-13(16)17)19-15(22)20-6-8-21-9-7-20/h2-5,10H,6-9H2,1H3,(H,18,19,22).
What are the key properties of N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide?
N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide has a molecular weight of 358.29 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N-(2,2-dichloroethenyl)-C-(4-methylphenyl)carbonimidoyl]morpholine-4-carbothioamide is sourced from PubChem (CID 4224571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).