About naphthalene-1-sulfonate
naphthalene-1-sulfonate (PubChem CID 4224596) has the molecular formula C10H7O3S-
and a molecular weight of 207.23 g/mol. Its IUPAC name is naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | naphthalene-1-sulfonate |
| PubChem CID | 4224596 |
| Molecular Formula | C10H7O3S- |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | naphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,11,12,13)/p-1 |
| InChIKey | PSZYNBSKGUBXEH-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1-sulfonate?
The IUPAC name of naphthalene-1-sulfonate (CID 4224596) is naphthalene-1-sulfonate.
What is the SMILES notation for naphthalene-1-sulfonate?
The canonical SMILES for naphthalene-1-sulfonate is O=S(=O)([O-])c1cccc2ccccc12.
What is the InChIKey of naphthalene-1-sulfonate?
The InChIKey is PSZYNBSKGUBXEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8O3S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,11,12,13)/p-1.
What are the key properties of naphthalene-1-sulfonate?
naphthalene-1-sulfonate has a molecular weight of 207.23 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1-sulfonate is sourced from PubChem (CID 4224596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).