C19H23N3O3S — CID 42247455
3-[(2R)-5-oxo-2-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-N-(2-pyridin-3-yloxyethyl)propanamide (PubChem CID 42247455) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[(2R)-5-oxo-2-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-N-(2-pyridin-3-yloxyethyl)propanamide.
| Compound Name | 3-[(2R)-5-oxo-2-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-N-(2-pyridin-3-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 42247455 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[(2R)-5-oxo-2-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-N-(2-pyridin-3-yloxyethyl)propanamide |
| SMILES | O=C(CC[C@@]1(Cc2cccs2)CCC(=O)N1)NCCOc1cccnc1 |
| InChI | InChI=1S/C19H23N3O3S/c23-17(21-10-11-25-15-3-1-9-20-14-15)5-7-19(8-6-18(24)22-19)13-16-4-2-12-26-16/h1-4,9,12,14H,5-8,10-11,13H2,(H,21,23)(H,22,24)/t19-/m0/s1 |
| InChIKey | WTZRTAFUYWAOHA-IBGZPJMESA-N |
| XLogP | 2.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|