About 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one
1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one (PubChem CID 42248005) has the molecular formula C23H24N4O3
and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one |
| PubChem CID | 42248005 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one |
| SMILES | COc1ccc(N2C(=O)CN(C(=O)c3cccc(-n4cccn4)c3)CC2(C)C)cc1 |
| InChI | InChI=1S/C23H24N4O3/c1-23(2)16-25(15-21(28)27(23)18-8-10-20(30-3)11-9-18)22(29)17-6-4-7-19(14-17)26-13-5-12-24-26/h4-14H,15-16H2,1-3H3 |
| InChIKey | VDASECWFLPXICX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one?
The IUPAC name of 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one (CID 42248005) is 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one.
What is the SMILES notation for 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one?
The canonical SMILES for 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one is COc1ccc(N2C(=O)CN(C(=O)c3cccc(-n4cccn4)c3)CC2(C)C)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one?
The InChIKey is VDASECWFLPXICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O3/c1-23(2)16-25(15-21(28)27(23)18-8-10-20(30-3)11-9-18)22(29)17-6-4-7-19(14-17)26-13-5-12-24-26/h4-14H,15-16H2,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one?
1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one has a molecular weight of 404.47 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-6,6-dimethyl-4-(3-pyrazol-1-ylbenzoyl)piperazin-2-one is sourced from PubChem (CID 42248005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).