C24H23ClF2N2O3 — CID 42248164
(2R)-N-(3-chloro-4-methoxyphenyl)-6-[(E)-3-(2,3-difluorophenyl)prop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42248164) has the molecular formula C24H23ClF2N2O3 and a molecular weight of 460.91 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-methoxyphenyl)-6-[(E)-3-(2,3-difluorophenyl)prop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-N-(3-chloro-4-methoxyphenyl)-6-[(E)-3-(2,3-difluorophenyl)prop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42248164 |
| Molecular Formula | C24H23ClF2N2O3 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (2R)-N-(3-chloro-4-methoxyphenyl)-6-[(E)-3-(2,3-difluorophenyl)prop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC23CCN(C(=O)/C=C/c2cccc(F)c2F)CC3)cc1Cl |
| InChI | InChI=1S/C24H23ClF2N2O3/c1-32-20-7-6-16(13-18(20)25)28-23(31)17-14-24(17)9-11-29(12-10-24)21(30)8-5-15-3-2-4-19(26)22(15)27/h2-8,13,17H,9-12,14H2,1H3,(H,28,31)/b8-5+/t17-/m0/s1 |
| InChIKey | MAXXVXYRGZGKML-JZLODUJNSA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|