About 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate
2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate (PubChem CID 42251579) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 42251579 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate |
| SMILES | C[C@@H]([NH3+])c1nc(C(=O)[O-])cs1 |
| InChI | InChI=1S/C6H8N2O2S/c1-3(7)5-8-4(2-11-5)6(9)10/h2-3H,7H2,1H3,(H,9,10)/t3-/m1/s1 |
| InChIKey | IZYPOVIPPSQRBI-GSVOUGTGSA-N |
| XLogP | -1.19 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate (CID 42251579) is 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate is C[C@@H]([NH3+])c1nc(C(=O)[O-])cs1.
What is the InChIKey of 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate?
The InChIKey is IZYPOVIPPSQRBI-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3(7)5-8-4(2-11-5)6(9)10/h2-3H,7H2,1H3,(H,9,10)/t3-/m1/s1.
What are the key properties of 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate?
2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate has a molecular weight of 172.21 g/mol, XLogP of -1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-azaniumylethyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 42251579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).