(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid

C12H13Cl2NO3 — CID 42255555

IUPAC(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid
SMILESCC(C)[C@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H13Cl2NO3/c1-6(2)10(12(17)18)15-11(16)7-3-4-8(13)9(14)5-7/h3-6,10H,1-2H3,(H,15,16)(H,17,18)/t10-/m0/s1
InChIKeyANIZAGJLZDYFHW-JTQLQIEISA-N
MW290.15 g/mol
LogP2.83
Rot. Bonds4

About (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid

(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid (PubChem CID 42255555) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid
PubChem CID42255555
Molecular FormulaC12H13Cl2NO3
Molecular Weight290.15 g/mol
Exact Mass289.03
IUPAC Name(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid
SMILESCC(C)[C@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H13Cl2NO3/c1-6(2)10(12(17)18)15-11(16)7-3-4-8(13)9(14)5-7/h3-6,10H,1-2H3,(H,15,16)(H,17,18)/t10-/m0/s1
InChIKeyANIZAGJLZDYFHW-JTQLQIEISA-N
XLogP2.83
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.15
LogP ≤ 52.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid?
The IUPAC name of (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid (CID 42255555) is (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid is CC(C)[C@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid?
The InChIKey is ANIZAGJLZDYFHW-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-6(2)10(12(17)18)15-11(16)7-3-4-8(13)9(14)5-7/h3-6,10H,1-2H3,(H,15,16)(H,17,18)/t10-/m0/s1.
What are the key properties of (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid?
(2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid has a molecular weight of 290.15 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3,4-dichlorobenzoyl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 42255555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).