C10H12F9N3O — CID 4225683
2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methylpiperazin-1-yl)pentanamide (PubChem CID 4225683) has the molecular formula C10H12F9N3O and a molecular weight of 361.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methylpiperazin-1-yl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methylpiperazin-1-yl)pentanamide |
|---|---|
| PubChem CID | 4225683 |
| Molecular Formula | C10H12F9N3O |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methylpiperazin-1-yl)pentanamide |
| SMILES | CN1CCN(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F9N3O/c1-21-2-4-22(5-3-21)20-6(23)7(11,12)8(13,14)9(15,16)10(17,18)19/h2-5H2,1H3,(H,20,23) |
| InChIKey | LTNGOSNEKPJJBY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|