C29H32N2O4+2 — CID 4225708
1-[1,3-bis[(2-hydroxyphenyl)methyl]imidazolidine-1,3-diium-2-yl]-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 4225708) has the molecular formula C29H32N2O4+2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[1,3-bis[(2-hydroxyphenyl)methyl]imidazolidine-1,3-diium-2-yl]-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 1-[1,3-bis[(2-hydroxyphenyl)methyl]imidazolidine-1,3-diium-2-yl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 4225708 |
| Molecular Formula | C29H32N2O4+2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[1,3-bis[(2-hydroxyphenyl)methyl]imidazolidine-1,3-diium-2-yl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | Oc1ccccc1C[NH+]1CC[NH+](Cc2ccccc2O)C1c1c(O)ccc2oc3c(c12)CCCC3 |
| InChI | InChI=1S/C29H30N2O4/c32-22-10-4-1-7-19(22)17-30-15-16-31(18-20-8-2-5-11-23(20)33)29(30)28-24(34)13-14-26-27(28)21-9-3-6-12-25(21)35-26/h1-2,4-5,7-8,10-11,13-14,29,32-34H,3,6,9,12,15-18H2/p+2 |
| InChIKey | UJTRVSASVXAHQX-UHFFFAOYSA-P |
| XLogP | 2.61 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|