C18H19N3O2S — CID 42260896
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide (PubChem CID 42260896) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 42260896 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide |
| SMILES | C[C@@H](NC(=O)CSc1nccn1C1CC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12(16-10-13-4-2-3-5-15(13)23-16)20-17(22)11-24-18-19-8-9-21(18)14-6-7-14/h2-5,8-10,12,14H,6-7,11H2,1H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | YBMAWADXFIEKGU-GFCCVEGCSA-N |
| XLogP | 3.93 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |