C27H30N2O2+2 — CID 4226166
1-(4-ethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazine-1,4-diium-1-yl]ethanone (PubChem CID 4226166) has the molecular formula C27H30N2O2+2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazine-1,4-diium-1-yl]ethanone.
| Compound Name | 1-(4-ethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazine-1,4-diium-1-yl]ethanone |
|---|---|
| PubChem CID | 4226166 |
| Molecular Formula | C27H30N2O2+2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazine-1,4-diium-1-yl]ethanone |
| SMILES | CCOc1ccc(C(=O)C[NH+]2CC[NH+](C3c4ccccc4-c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-2-31-21-13-11-20(12-14-21)26(30)19-28-15-17-29(18-16-28)27-24-9-5-3-7-22(24)23-8-4-6-10-25(23)27/h3-14,27H,2,15-19H2,1H3/p+2 |
| InChIKey | AIKDLHXVABWTGL-UHFFFAOYSA-P |
| XLogP | 1.82 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |