C21H22F3N3O2S — CID 4226471
6-tert-butylimino-5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 4226471) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is 6-tert-butylimino-5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
| Compound Name | 6-tert-butylimino-5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 4226471 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 6-tert-butylimino-5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | COc1ccc(N2C(=O)NC(c3ccccc3)(C(F)(F)F)S/C2=N\C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H22F3N3O2S/c1-19(2,3)26-18-27(15-10-12-16(29-4)13-11-15)17(28)25-20(30-18,21(22,23)24)14-8-6-5-7-9-14/h5-13H,1-4H3,(H,25,28)/b26-18- |
| InChIKey | SAZVCVPUFLNCES-ITYLOYPMSA-N |
| XLogP | 5.53 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|