C17H14ClFN2O3 — CID 42266014
5-chloro-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-nitrobenzamide (PubChem CID 42266014) has the molecular formula C17H14ClFN2O3 and a molecular weight of 348.76 g/mol. Its IUPAC name is 5-chloro-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 42266014 |
| Molecular Formula | C17H14ClFN2O3 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 5-chloro-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-nitrobenzamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CC1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClFN2O3/c18-12-3-6-15(21(23)24)14(9-12)16(22)20-10-17(7-8-17)11-1-4-13(19)5-2-11/h1-6,9H,7-8,10H2,(H,20,22) |
| InChIKey | CFOOCBOTRFMEBD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|