C17H19N3O3S — CID 42270765
6-(3-methoxyphenyl)-N-(3-methoxypropyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 42270765) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-N-(3-methoxypropyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 6-(3-methoxyphenyl)-N-(3-methoxypropyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 42270765 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 6-(3-methoxyphenyl)-N-(3-methoxypropyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | COCCCNC(=O)c1csc2nc(-c3cccc(OC)c3)cn12 |
| InChI | InChI=1S/C17H19N3O3S/c1-22-8-4-7-18-16(21)15-11-24-17-19-14(10-20(15)17)12-5-3-6-13(9-12)23-2/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,18,21) |
| InChIKey | ATYAKEKXEDUZRA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|