C21H24N2O4S — CID 42271223
(4aS,7aR)-4-(4-ethoxyphenyl)-1-(4-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 42271223) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (4aS,7aR)-4-(4-ethoxyphenyl)-1-(4-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-4-(4-ethoxyphenyl)-1-(4-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 42271223 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (4aS,7aR)-4-(4-ethoxyphenyl)-1-(4-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | CCOc1ccc(N2C(=O)CN(c3ccc(C)cc3)[C@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-3-27-18-10-8-17(9-11-18)23-20-14-28(25,26)13-19(20)22(12-21(23)24)16-6-4-15(2)5-7-16/h4-11,19-20H,3,12-14H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | URDGEYUCAAFQKK-VQTJNVASSA-N |
| XLogP | 2.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|