C19H14N4O2S — CID 42271610
N-(4-carbamoylphenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 42271610) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 42271610 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(4-carbamoylphenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2csc3nc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C19H14N4O2S/c20-17(24)13-6-8-14(9-7-13)21-18(25)16-11-26-19-22-15(10-23(16)19)12-4-2-1-3-5-12/h1-11H,(H2,20,24)(H,21,25) |
| InChIKey | HLWREGZXJPCTHB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |