C10H10N2O2 — CID 4227170
3-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 4227170) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 4227170 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | CC1NC(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C10H10N2O2/c1-6-9(13)12-8-5-3-2-4-7(8)10(14)11-6/h2-6H,1H3,(H,11,14)(H,12,13) |
| InChIKey | LJONQULKOKMKBR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |