2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid

C15H11N3O7 — CID 4227551

IUPAC2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid
SMILESCc1ccc(NC(=O)c2c(C(=O)O)cccc2[N+](=O)[O-])c([N+](=O)[O-])c1
InChIInChI=1S/C15H11N3O7/c1-8-5-6-10(12(7-8)18(24)25)16-14(19)13-9(15(20)21)3-2-4-11(13)17(22)23/h2-7H,1H3,(H,16,19)(H,20,21)
InChIKeyRUTRIPZHMCLWJH-UHFFFAOYSA-N
MW345.27 g/mol
LogP2.76
Rot. Bonds5

About 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid

2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid (PubChem CID 4227551) has the molecular formula C15H11N3O7 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid.

Molecular Properties

Compound Name2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid
PubChem CID4227551
Molecular FormulaC15H11N3O7
Molecular Weight345.27 g/mol
Exact Mass345.06
IUPAC Name2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid
SMILESCc1ccc(NC(=O)c2c(C(=O)O)cccc2[N+](=O)[O-])c([N+](=O)[O-])c1
InChIInChI=1S/C15H11N3O7/c1-8-5-6-10(12(7-8)18(24)25)16-14(19)13-9(15(20)21)3-2-4-11(13)17(22)23/h2-7H,1H3,(H,16,19)(H,20,21)
InChIKeyRUTRIPZHMCLWJH-UHFFFAOYSA-N
XLogP2.76
TPSA152.68 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.27
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid?
The IUPAC name of 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid (CID 4227551) is 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid.
What is the SMILES notation for 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid?
The canonical SMILES for 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid is Cc1ccc(NC(=O)c2c(C(=O)O)cccc2[N+](=O)[O-])c([N+](=O)[O-])c1.
What is the InChIKey of 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid?
The InChIKey is RUTRIPZHMCLWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O7/c1-8-5-6-10(12(7-8)18(24)25)16-14(19)13-9(15(20)21)3-2-4-11(13)17(22)23/h2-7H,1H3,(H,16,19)(H,20,21).
What are the key properties of 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid?
2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid has a molecular weight of 345.27 g/mol, XLogP of 2.76, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-2-nitrophenyl)carbamoyl]-3-nitrobenzoic acid is sourced from PubChem (CID 4227551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).