C27H31FN4O2 — CID 42276956
N-[(2-fluorophenyl)methyl]-4-[4-(3-pyridin-3-yloxypropylamino)piperidin-1-yl]benzamide (PubChem CID 42276956) has the molecular formula C27H31FN4O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-[4-(3-pyridin-3-yloxypropylamino)piperidin-1-yl]benzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-[4-(3-pyridin-3-yloxypropylamino)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42276956 |
| Molecular Formula | C27H31FN4O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-[4-(3-pyridin-3-yloxypropylamino)piperidin-1-yl]benzamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc(N2CCC(NCCCOc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C27H31FN4O2/c28-26-7-2-1-5-22(26)19-31-27(33)21-8-10-24(11-9-21)32-16-12-23(13-17-32)30-15-4-18-34-25-6-3-14-29-20-25/h1-3,5-11,14,20,23,30H,4,12-13,15-19H2,(H,31,33) |
| InChIKey | QMEJRWJUQNNJCC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|