About 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid
4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 4227726) has the molecular formula C9H15ClO2
and a molecular weight of 190.67 g/mol. Its IUPAC name is 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid |
| PubChem CID | 4227726 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1(Cl)CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C9H15ClO2/c1-8(7(11)12)3-5-9(2,10)6-4-8/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | LANSGLVHTKMZNO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid?
The IUPAC name of 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid (CID 4227726) is 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid?
The canonical SMILES for 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid is CC1(Cl)CCC(C)(C(=O)O)CC1.
What is the InChIKey of 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid?
The InChIKey is LANSGLVHTKMZNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO2/c1-8(7(11)12)3-5-9(2,10)6-4-8/h3-6H2,1-2H3,(H,11,12).
What are the key properties of 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid?
4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid has a molecular weight of 190.67 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,4-dimethylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 4227726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).