C20H18N2O3 — CID 42280319
N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-1H-indole-2-carboxamide (PubChem CID 42280319) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-1H-indole-2-carboxamide.
| Compound Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 42280319 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H18N2O3/c23-19(16-11-13-5-1-2-6-15(13)22-16)21-14-7-8-17-18(12-14)25-20(24-17)9-3-4-10-20/h1-2,5-8,11-12,22H,3-4,9-10H2,(H,21,23) |
| InChIKey | MUAQHXUXMGSMGJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |