C20H20IN3O3 — CID 42281330
4-iodo-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]benzamide (PubChem CID 42281330) has the molecular formula C20H20IN3O3 and a molecular weight of 477.30 g/mol. Its IUPAC name is 4-iodo-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-iodo-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42281330 |
| Molecular Formula | C20H20IN3O3 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 4-iodo-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]benzamide |
| SMILES | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CN(C)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H20IN3O3/c1-13-11-18(25)22-16-5-3-4-6-17(16)24(13)19(26)12-23(2)20(27)14-7-9-15(21)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | NLIDIKZIEAKBJA-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|