About 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole
1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 42281468) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole |
| PubChem CID | 42281468 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | c1ncn(C[C@H]2CO2)n1 |
| InChI | InChI=1S/C5H7N3O/c1(5-2-9-5)8-4-6-3-7-8/h3-5H,1-2H2/t5-/m0/s1 |
| InChIKey | MREIWMUBFBUHRK-YFKPBYRVSA-N |
| XLogP | -0.32 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole?
The IUPAC name of 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole (CID 42281468) is 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole.
What is the SMILES notation for 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole?
The canonical SMILES for 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole is c1ncn(C[C@H]2CO2)n1.
What is the InChIKey of 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole?
The InChIKey is MREIWMUBFBUHRK-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H7N3O/c1(5-2-9-5)8-4-6-3-7-8/h3-5H,1-2H2/t5-/m0/s1.
What are the key properties of 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole?
1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole has a molecular weight of 125.13 g/mol, XLogP of -0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S)-oxiran-2-yl]methyl]-1,2,4-triazole is sourced from PubChem (CID 42281468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).