About 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole
5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole (PubChem CID 42281790) has the molecular formula C8H5ClF2N4
and a molecular weight of 230.61 g/mol. Its IUPAC name is 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole |
| PubChem CID | 42281790 |
| Molecular Formula | C8H5ClF2N4 |
| Molecular Weight | 230.61 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole |
| SMILES | Fc1ccc(-n2nnnc2CCl)cc1F |
| InChI | InChI=1S/C8H5ClF2N4/c9-4-8-12-13-14-15(8)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| InChIKey | DXQIOGZINBZREL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole?
The IUPAC name of 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole (CID 42281790) is 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole.
What is the SMILES notation for 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole?
The canonical SMILES for 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole is Fc1ccc(-n2nnnc2CCl)cc1F.
What is the InChIKey of 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole?
The InChIKey is DXQIOGZINBZREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2N4/c9-4-8-12-13-14-15(8)5-1-2-6(10)7(11)3-5/h1-3H,4H2.
What are the key properties of 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole?
5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole has a molecular weight of 230.61 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1-(3,4-difluorophenyl)tetrazole is sourced from PubChem (CID 42281790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).