About 2-amino-N-methyl-1,3-thiazole-4-carboxamide
2-amino-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 42281846) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-amino-N-methyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-methyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 42281846 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-amino-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C5H7N3OS/c1-7-4(9)3-2-10-5(6)8-3/h2H,1H3,(H2,6,8)(H,7,9) |
| InChIKey | YPOSKWMFWUTTAJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-methyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-methyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-amino-N-methyl-1,3-thiazole-4-carboxamide (CID 42281846) is 2-amino-N-methyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-amino-N-methyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-amino-N-methyl-1,3-thiazole-4-carboxamide is CNC(=O)c1csc(N)n1.
What is the InChIKey of 2-amino-N-methyl-1,3-thiazole-4-carboxamide?
The InChIKey is YPOSKWMFWUTTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3OS/c1-7-4(9)3-2-10-5(6)8-3/h2H,1H3,(H2,6,8)(H,7,9).
What are the key properties of 2-amino-N-methyl-1,3-thiazole-4-carboxamide?
2-amino-N-methyl-1,3-thiazole-4-carboxamide has a molecular weight of 157.20 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-methyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 42281846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).