About 2-amino-N-ethyl-1,3-thiazole-4-carboxamide
2-amino-N-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 42281847) has the molecular formula C6H9N3OS
and a molecular weight of 171.23 g/mol. Its IUPAC name is 2-amino-N-ethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-ethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 42281847 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-amino-N-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C6H9N3OS/c1-2-8-5(10)4-3-11-6(7)9-4/h3H,2H2,1H3,(H2,7,9)(H,8,10) |
| InChIKey | ZLCICGBDZSRXJW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-ethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-ethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-amino-N-ethyl-1,3-thiazole-4-carboxamide (CID 42281847) is 2-amino-N-ethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-amino-N-ethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-amino-N-ethyl-1,3-thiazole-4-carboxamide is CCNC(=O)c1csc(N)n1.
What is the InChIKey of 2-amino-N-ethyl-1,3-thiazole-4-carboxamide?
The InChIKey is ZLCICGBDZSRXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-2-8-5(10)4-3-11-6(7)9-4/h3H,2H2,1H3,(H2,7,9)(H,8,10).
What are the key properties of 2-amino-N-ethyl-1,3-thiazole-4-carboxamide?
2-amino-N-ethyl-1,3-thiazole-4-carboxamide has a molecular weight of 171.23 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-ethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 42281847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).