C11H12N2O2 — CID 42281871
[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 42281871) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 42281871 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | COc1ccc(-c2cc(CN)no2)cc1 |
| InChI | InChI=1S/C11H12N2O2/c1-14-10-4-2-8(3-5-10)11-6-9(7-12)13-15-11/h2-6H,7,12H2,1H3 |
| InChIKey | JEVVHEACJGXPMC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |