About N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide
N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 42282214) has the molecular formula C10H19N3O3S
and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide |
| PubChem CID | 42282214 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCOCCCNS(=O)(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C10H19N3O3S/c1-4-16-7-5-6-11-17(14,15)10-8-13(3)12-9(10)2/h8,11H,4-7H2,1-3H3 |
| InChIKey | YDJREROBJFBPNM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide?
The IUPAC name of N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide (CID 42282214) is N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide.
What is the SMILES notation for N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide?
The canonical SMILES for N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide is CCOCCCNS(=O)(=O)c1cn(C)nc1C.
What is the InChIKey of N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide?
The InChIKey is YDJREROBJFBPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O3S/c1-4-16-7-5-6-11-17(14,15)10-8-13(3)12-9(10)2/h8,11H,4-7H2,1-3H3.
What are the key properties of N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide?
N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide has a molecular weight of 261.35 g/mol, XLogP of 0.43, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide is sourced from PubChem (CID 42282214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).