About 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide
1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide (PubChem CID 42282261) has the molecular formula C8H10N4O2S2
and a molecular weight of 258.33 g/mol. Its IUPAC name is 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide |
| PubChem CID | 42282261 |
| Molecular Formula | C8H10N4O2S2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H10N4O2S2/c1-6-7(5-12(2)10-6)16(13,14)11-8-9-3-4-15-8/h3-5H,1-2H3,(H,9,11) |
| InChIKey | SLBYJYJBVZCDFC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide?
The IUPAC name of 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide (CID 42282261) is 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide.
What is the SMILES notation for 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide?
The canonical SMILES for 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide is Cc1nn(C)cc1S(=O)(=O)Nc1nccs1.
What is the InChIKey of 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide?
The InChIKey is SLBYJYJBVZCDFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S2/c1-6-7(5-12(2)10-6)16(13,14)11-8-9-3-4-15-8/h3-5H,1-2H3,(H,9,11).
What are the key properties of 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide?
1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide has a molecular weight of 258.33 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide is sourced from PubChem (CID 42282261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).