About 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide
1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide (PubChem CID 42282720) has the molecular formula C24H29N3O2S
and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide |
| PubChem CID | 42282720 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C2CCCC2)cc1S(=O)(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-19-24(18-27(26-19)22-14-8-9-15-22)30(28,29)25-17-16-23(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-7,10-13,18,22-23,25H,8-9,14-17H2,1H3 |
| InChIKey | RBSDSLUFVRGVOK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide?
The IUPAC name of 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide (CID 42282720) is 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide.
What is the SMILES notation for 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide?
The canonical SMILES for 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide is Cc1nn(C2CCCC2)cc1S(=O)(=O)NCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide?
The InChIKey is RBSDSLUFVRGVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2S/c1-19-24(18-27(26-19)22-14-8-9-15-22)30(28,29)25-17-16-23(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-7,10-13,18,22-23,25H,8-9,14-17H2,1H3.
What are the key properties of 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide?
1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide has a molecular weight of 423.58 g/mol, XLogP of 4.81, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-(3,3-diphenylpropyl)-3-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 42282720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).