About 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide
1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide (PubChem CID 42282807) has the molecular formula C15H21N5O4S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide |
| PubChem CID | 42282807 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C2CCCC2)cc1S(=O)(=O)Nc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H21N5O4S/c1-10-12(9-20(16-10)11-6-4-5-7-11)25(23,24)17-13-8-14(21)19(3)15(22)18(13)2/h8-9,11,17H,4-7H2,1-3H3 |
| InChIKey | MXOPBSOQVHKHIE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide?
The IUPAC name of 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide (CID 42282807) is 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide.
What is the SMILES notation for 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide?
The canonical SMILES for 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide is Cc1nn(C2CCCC2)cc1S(=O)(=O)Nc1cc(=O)n(C)c(=O)n1C.
What is the InChIKey of 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide?
The InChIKey is MXOPBSOQVHKHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O4S/c1-10-12(9-20(16-10)11-6-4-5-7-11)25(23,24)17-13-8-14(21)19(3)15(22)18(13)2/h8-9,11,17H,4-7H2,1-3H3.
What are the key properties of 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide?
1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide has a molecular weight of 367.43 g/mol, XLogP of 0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 42282807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).